C18H21FN4O — CID 143569431
(3E,5Z)-3-[4-(2-aminopropylamino)quinazolin-2-yl]-2-fluorohepta-1,3,5-trien-4-ol (PubChem CID 143569431) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is (3E,5Z)-3-[4-(2-aminopropylamino)quinazolin-2-yl]-2-fluorohepta-1,3,5-trien-4-ol.
| Compound Name | (3E,5Z)-3-[4-(2-aminopropylamino)quinazolin-2-yl]-2-fluorohepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 143569431 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3E,5Z)-3-[4-(2-aminopropylamino)quinazolin-2-yl]-2-fluorohepta-1,3,5-trien-4-ol |
| SMILES | C=C(F)/C(=C(O)\C=C/C)c1nc(NCC(C)N)c2ccccc2n1 |
| InChI | InChI=1S/C18H21FN4O/c1-4-7-15(24)16(12(3)19)18-22-14-9-6-5-8-13(14)17(23-18)21-10-11(2)20/h4-9,11,24H,3,10,20H2,1-2H3,(H,21,22,23)/b7-4-,16-15- |
| InChIKey | ZHXMXLLNTLOCTJ-RQBSCIGTSA-N |
| XLogP | 3.72 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|