C17H19ClN4O — CID 143569346
(2E,4Z)-4-[4-(2-aminoethylamino)quinazolin-2-yl]-6-chlorohepta-2,4,6-trien-3-ol (PubChem CID 143569346) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is (2E,4Z)-4-[4-(2-aminoethylamino)quinazolin-2-yl]-6-chlorohepta-2,4,6-trien-3-ol.
| Compound Name | (2E,4Z)-4-[4-(2-aminoethylamino)quinazolin-2-yl]-6-chlorohepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 143569346 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2E,4Z)-4-[4-(2-aminoethylamino)quinazolin-2-yl]-6-chlorohepta-2,4,6-trien-3-ol |
| SMILES | C=C(Cl)/C=C(C(\O)=C/C)/c1nc(NCCN)c2ccccc2n1 |
| InChI | InChI=1S/C17H19ClN4O/c1-3-15(23)13(10-11(2)18)17-21-14-7-5-4-6-12(14)16(22-17)20-9-8-19/h3-7,10,23H,2,8-9,19H2,1H3,(H,20,21,22)/b13-10+,15-3- |
| InChIKey | SWLHGMXBNFPWFM-FHHHVOGJSA-N |
| XLogP | 3.60 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|