C17H16N4O4 — CID 135899670
methyl 4-[(5R)-6-oxo-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-5-yl]benzoate (PubChem CID 135899670) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is methyl 4-[(5R)-6-oxo-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-5-yl]benzoate.
| Compound Name | methyl 4-[(5R)-6-oxo-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-5-yl]benzoate |
|---|---|
| PubChem CID | 135899670 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | methyl 4-[(5R)-6-oxo-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C17H16N4O4/c1-24-17(23)10-7-5-9(6-8-10)14-13-11(3-2-4-12(13)22)18-15-16(19-14)21-25-20-15/h5-8,14H,2-4H2,1H3,(H,18,20)(H,19,21)/t14-/m1/s1 |
| InChIKey | FMBXAJRZVAYYSF-CQSZACIVSA-N |
| XLogP | 2.44 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |