C12H12BrN3O2 — CID 135900509
3-bromo-N-hydroxy-N'-[(2-methylphenyl)methyl]-1,2-oxazole-5-carboximidamide (PubChem CID 135900509) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is 3-bromo-N-hydroxy-N'-[(2-methylphenyl)methyl]-1,2-oxazole-5-carboximidamide.
| Compound Name | 3-bromo-N-hydroxy-N'-[(2-methylphenyl)methyl]-1,2-oxazole-5-carboximidamide |
|---|---|
| PubChem CID | 135900509 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 3-bromo-N-hydroxy-N'-[(2-methylphenyl)methyl]-1,2-oxazole-5-carboximidamide |
| SMILES | Cc1ccccc1C/N=C(\NO)c1cc(Br)no1 |
| InChI | InChI=1S/C12H12BrN3O2/c1-8-4-2-3-5-9(8)7-14-12(15-17)10-6-11(13)16-18-10/h2-6,17H,7H2,1H3,(H,14,15) |
| InChIKey | PMHDTGUCTDIGQU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|