C19H15Cl2N5O2S — CID 135904118
2-[(6S)-2-benzylsulfanyl-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 135904118) has the molecular formula C19H15Cl2N5O2S and a molecular weight of 448.34 g/mol. Its IUPAC name is 2-[(6S)-2-benzylsulfanyl-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(6S)-2-benzylsulfanyl-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 135904118 |
| Molecular Formula | C19H15Cl2N5O2S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-[(6S)-2-benzylsulfanyl-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(C[C@H]1C(=O)Nc2nc(SCc3ccccc3)nn21)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2N5O2S/c20-12-6-7-14(13(21)8-12)22-16(27)9-15-17(28)23-18-24-19(25-26(15)18)29-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,22,27)(H,23,24,25,28)/t15-/m0/s1 |
| InChIKey | LQJVPJGAGWXOPY-HNNXBMFYSA-N |
| XLogP | 4.40 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |