C20H27N3O2 — CID 135904863
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide (PubChem CID 135904863) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 135904863 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H27N3O2/c1-13-7-5-10-16(14(13)2)22-19(24)12-6-11-18-21-17-9-4-3-8-15(17)20(25)23-18/h3-4,8-9,13-14,16H,5-7,10-12H2,1-2H3,(H,22,24)(H,21,23,25)/t13-,14-,16+/m1/s1 |
| InChIKey | VPMVGRKXRAXDTJ-FMKPAKJESA-N |
| XLogP | 3.19 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |