C21H27N3O4 — CID 137133644
4-ethyl-1-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 137133644) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-ethyl-1-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 137133644 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-ethyl-1-[4-(4-oxo-3H-quinazolin-2-yl)butanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(NC(=O)CCCc2nc3ccccc3c(=O)[nH]2)(C(=O)O)CC1 |
| InChI | InChI=1S/C21H27N3O4/c1-2-14-10-12-21(13-11-14,20(27)28)24-18(25)9-5-8-17-22-16-7-4-3-6-15(16)19(26)23-17/h3-4,6-7,14H,2,5,8-13H2,1H3,(H,24,25)(H,27,28)(H,22,23,26) |
| InChIKey | ZVCPHZCDHMBEDJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |