About N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one
N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one (PubChem CID 144584648) has the molecular formula C23H28N4O3
and a molecular weight of 408.50 g/mol. Its IUPAC name is N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one.
Molecular Properties
| Compound Name | N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one |
| PubChem CID | 144584648 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one |
| SMILES | O=C(CCCc1nc2ccccc2c(=O)[nH]1)NC1CCCCC1.O=c1cc[nH]cc1 |
| InChI | InChI=1S/C18H23N3O2.C5H5NO/c22-17(19-13-7-2-1-3-8-13)12-6-11-16-20-15-10-5-4-9-14(15)18(23)21-16;7-5-1-3-6-4-2-5/h4-5,9-10,13H,1-3,6-8,11-12H2,(H,19,22)(H,20,21,23);1-4H,(H,6,7) |
| InChIKey | WWZFIADZPLWEKT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one?
The IUPAC name of N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one (CID 144584648) is N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one.
What is the SMILES notation for N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one?
The canonical SMILES for N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one is O=C(CCCc1nc2ccccc2c(=O)[nH]1)NC1CCCCC1.O=c1cc[nH]cc1.
What is the InChIKey of N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one?
The InChIKey is WWZFIADZPLWEKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2.C5H5NO/c22-17(19-13-7-2-1-3-8-13)12-6-11-16-20-15-10-5-4-9-14(15)18(23)21-16;7-5-1-3-6-4-2-5/h4-5,9-10,13H,1-3,6-8,11-12H2,(H,19,22)(H,20,21,23);1-4H,(H,6,7).
What are the key properties of N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one?
N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one has a molecular weight of 408.50 g/mol, XLogP of 3.07, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide;1H-pyridin-4-one is sourced from PubChem (CID 144584648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).