C23H26ClN3O3S — CID 144584687
4-chlorophenol;N-cyclohexyl-3-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide (PubChem CID 144584687) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 4-chlorophenol;N-cyclohexyl-3-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide.
| Compound Name | 4-chlorophenol;N-cyclohexyl-3-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 144584687 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 4-chlorophenol;N-cyclohexyl-3-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide |
| SMILES | O=C(CCSc1nc2ccccc2c(=O)[nH]1)NC1CCCCC1.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21N3O2S.C6H5ClO/c21-15(18-12-6-2-1-3-7-12)10-11-23-17-19-14-9-5-4-8-13(14)16(22)20-17;7-5-1-3-6(8)4-2-5/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,18,21)(H,19,20,22);1-4,8H |
| InChIKey | KIAXOBZPMWCOAK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |