C24H30ClN5O3 — CID 135907754
methyl 2-amino-3-[3-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)piperazin-1-yl]propoxy]propanoate (PubChem CID 135907754) has the molecular formula C24H30ClN5O3 and a molecular weight of 471.99 g/mol. Its IUPAC name is methyl 2-amino-3-[3-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)piperazin-1-yl]propoxy]propanoate.
| Compound Name | methyl 2-amino-3-[3-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)piperazin-1-yl]propoxy]propanoate |
|---|---|
| PubChem CID | 135907754 |
| Molecular Formula | C24H30ClN5O3 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | methyl 2-amino-3-[3-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)piperazin-1-yl]propoxy]propanoate |
| SMILES | COC(=O)C(N)COCCCN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C24H30ClN5O3/c1-32-24(31)19(26)16-33-14-4-9-29-10-12-30(13-11-29)23-18-5-2-3-6-20(18)27-21-8-7-17(25)15-22(21)28-23/h2-3,5-8,15,19,27H,4,9-14,16,26H2,1H3 |
| InChIKey | JFJDCYKSQLVFCK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|