C26H27ClN5O+ — CID 135749866
N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-phenylacetamide (PubChem CID 135749866) has the molecular formula C26H27ClN5O+ and a molecular weight of 460.99 g/mol. Its IUPAC name is N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-phenylacetamide.
| Compound Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 135749866 |
| Molecular Formula | C26H27ClN5O+ |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-phenylacetamide |
| SMILES | C[N+]1(NC(=O)Cc2ccccc2)CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C26H26ClN5O/c1-32(30-25(33)17-19-7-3-2-4-8-19)15-13-31(14-16-32)26-21-9-5-6-10-22(21)28-23-12-11-20(27)18-24(23)29-26/h2-12,18H,13-17H2,1H3,(H-,28,29,30,33)/p+1 |
| InChIKey | IMWWWMNVKHQXNO-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|