C26H24ClF3N5O+ — CID 135796614
N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-4-(trifluoromethyl)benzamide (PubChem CID 135796614) has the molecular formula C26H24ClF3N5O+ and a molecular weight of 514.96 g/mol. Its IUPAC name is N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135796614 |
| Molecular Formula | C26H24ClF3N5O+ |
| Molecular Weight | 514.96 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-4-(trifluoromethyl)benzamide |
| SMILES | C[N+]1(NC(=O)c2ccc(C(F)(F)F)cc2)CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C26H23ClF3N5O/c1-35(33-25(36)17-6-8-18(9-7-17)26(28,29)30)14-12-34(13-15-35)24-20-4-2-3-5-21(20)31-22-11-10-19(27)16-23(22)32-24/h2-11,16H,12-15H2,1H3,(H-,31,32,33,36)/p+1 |
| InChIKey | HXODKLKVNLIYSG-UHFFFAOYSA-O |
| XLogP | 5.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.96 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|