C25H24Cl2N5O+ — CID 135796603
3-chloro-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]benzamide (PubChem CID 135796603) has the molecular formula C25H24Cl2N5O+ and a molecular weight of 481.41 g/mol. Its IUPAC name is 3-chloro-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]benzamide.
| Compound Name | 3-chloro-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]benzamide |
|---|---|
| PubChem CID | 135796603 |
| Molecular Formula | C25H24Cl2N5O+ |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-chloro-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]benzamide |
| SMILES | C[N+]1(NC(=O)c2cccc(Cl)c2)CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C25H23Cl2N5O/c1-32(30-25(33)17-5-4-6-18(26)15-17)13-11-31(12-14-32)24-20-7-2-3-8-21(20)28-22-10-9-19(27)16-23(22)29-24/h2-10,15-16H,11-14H2,1H3,(H-,28,29,30,33)/p+1 |
| InChIKey | XIZBFAGYRPSONJ-UHFFFAOYSA-O |
| XLogP | 5.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|