C25H25ClN5O2+ — CID 135796657
N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-3-hydroxybenzamide (PubChem CID 135796657) has the molecular formula C25H25ClN5O2+ and a molecular weight of 462.96 g/mol. Its IUPAC name is N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-3-hydroxybenzamide.
| Compound Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 135796657 |
| Molecular Formula | C25H25ClN5O2+ |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-3-hydroxybenzamide |
| SMILES | C[N+]1(NC(=O)c2cccc(O)c2)CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C25H24ClN5O2/c1-31(29-25(33)17-5-4-6-19(32)15-17)13-11-30(12-14-31)24-20-7-2-3-8-21(20)27-22-10-9-18(26)16-23(22)28-24/h2-10,15-16H,11-14H2,1H3,(H2-,27,28,29,32,33)/p+1 |
| InChIKey | YTVSXFAGSGPEPT-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|