C26H26ClN5O — CID 135796606
(1Z)-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-methylbenzenecarboximidate (PubChem CID 135796606) has the molecular formula C26H26ClN5O and a molecular weight of 459.98 g/mol. Its IUPAC name is (1Z)-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-methylbenzenecarboximidate.
| Compound Name | (1Z)-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 135796606 |
| Molecular Formula | C26H26ClN5O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (1Z)-N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-2-methylbenzenecarboximidate |
| SMILES | Cc1ccccc1/C([O-])=N/[N+]1(C)CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C26H26ClN5O/c1-18-7-3-4-8-20(18)26(33)30-32(2)15-13-31(14-16-32)25-21-9-5-6-10-22(21)28-23-12-11-19(27)17-24(23)29-25/h3-12,17H,13-16H2,1-2H3,(H-,28,29,30,33) |
| InChIKey | FAQLFLGAZXAIDV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|