C29H33ClN5O+ — CID 135749872
N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-5-phenylpentanamide (PubChem CID 135749872) has the molecular formula C29H33ClN5O+ and a molecular weight of 503.07 g/mol. Its IUPAC name is N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-5-phenylpentanamide.
| Compound Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 135749872 |
| Molecular Formula | C29H33ClN5O+ |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | N-[4-(3-chloro-11H-benzo[b][1,4]benzodiazepin-6-yl)-1-methylpiperazin-1-ium-1-yl]-5-phenylpentanamide |
| SMILES | C[N+]1(NC(=O)CCCCc2ccccc2)CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
| InChI | InChI=1S/C29H32ClN5O/c1-35(33-28(36)14-8-5-11-22-9-3-2-4-10-22)19-17-34(18-20-35)29-24-12-6-7-13-25(24)31-26-16-15-23(30)21-27(26)32-29/h2-4,6-7,9-10,12-13,15-16,21H,5,8,11,14,17-20H2,1H3,(H-,31,32,33,36)/p+1 |
| InChIKey | FJVAFAPARUQYDB-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|