C19H15Cl2N5O3S — CID 135909767
ethyl (2Z)-2-[5-[(4-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(4-chlorophenyl)hydrazinylidene]acetate (PubChem CID 135909767) has the molecular formula C19H15Cl2N5O3S and a molecular weight of 464.33 g/mol. Its IUPAC name is ethyl (2Z)-2-[5-[(4-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(4-chlorophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-[5-[(4-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(4-chlorophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 135909767 |
| Molecular Formula | C19H15Cl2N5O3S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | ethyl (2Z)-2-[5-[(4-chlorophenyl)diazenyl]-4-hydroxy-1,3-thiazol-2-yl]-2-[(4-chlorophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1ccc(Cl)cc1)c1nc(O)c(/N=N/c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C19H15Cl2N5O3S/c1-2-29-19(28)15(25-23-13-7-3-11(20)4-8-13)17-22-16(27)18(30-17)26-24-14-9-5-12(21)6-10-14/h3-10,23,27H,2H2,1H3/b25-15+,26-24+ |
| InChIKey | DFSVAXWKFKMIHO-JZQXFWJQSA-N |
| XLogP | 5.95 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|