C17H19F3N4O2 — CID 135911478
4-(methoxymethyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 135911478) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-(methoxymethyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135911478 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-(methoxymethyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | COCc1cc(=O)[nH]c(N2CCN(c3cccc(C(F)(F)F)c3)CC2)n1 |
| InChI | InChI=1S/C17H19F3N4O2/c1-26-11-13-10-15(25)22-16(21-13)24-7-5-23(6-8-24)14-4-2-3-12(9-14)17(18,19)20/h2-4,9-10H,5-8,11H2,1H3,(H,21,22,25) |
| InChIKey | YMURSAUOQBKACK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |