C17H20F3N5O2 — CID 142709645
methyl 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]triazole-4-carboxylate (PubChem CID 142709645) has the molecular formula C17H20F3N5O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is methyl 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 142709645 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | methyl 1-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)nn1 |
| InChI | InChI=1S/C17H20F3N5O2/c1-27-16(26)15-12-25(22-21-15)10-7-23-5-8-24(9-6-23)14-4-2-3-13(11-14)17(18,19)20/h2-4,11-12H,5-10H2,1H3 |
| InChIKey | IQSPGNXRRLLEPR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |