C23H24F3N5O — CID 11048500
phenyl-[1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]triazol-4-yl]methanone (PubChem CID 11048500) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is phenyl-[1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]triazol-4-yl]methanone.
| Compound Name | phenyl-[1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]triazol-4-yl]methanone |
|---|---|
| PubChem CID | 11048500 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | phenyl-[1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]triazol-4-yl]methanone |
| SMILES | O=C(c1ccccc1)c1cn(CCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)nn1 |
| InChI | InChI=1S/C23H24F3N5O/c24-23(25,26)19-8-4-9-20(16-19)30-14-12-29(13-15-30)10-5-11-31-17-21(27-28-31)22(32)18-6-2-1-3-7-18/h1-4,6-9,16-17H,5,10-15H2 |
| InChIKey | VIHNTIIHPSBINX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |