C33H33F3N6O4 — CID 135912289
N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[3-[4-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]acetamide (PubChem CID 135912289) has the molecular formula C33H33F3N6O4 and a molecular weight of 634.66 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[3-[4-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[3-[4-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 135912289 |
| Molecular Formula | C33H33F3N6O4 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[3-[4-[[2-(trifluoromethyl)phenoxy]methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]acetamide |
| SMILES | C=CCc1cccc(/C=N/NC(=O)CN2CCN(Cc3nc(-c4ccc(COc5ccccc5C(F)(F)F)cc4)no3)CC2)c1O |
| InChI | InChI=1S/C33H33F3N6O4/c1-2-6-24-7-5-8-26(31(24)44)19-37-39-29(43)20-41-15-17-42(18-16-41)21-30-38-32(40-46-30)25-13-11-23(12-14-25)22-45-28-10-4-3-9-27(28)33(34,35)36/h2-5,7-14,19,44H,1,6,15-18,20-22H2,(H,39,43)/b37-19+ |
| InChIKey | YZPRUHJNRHKZMN-SAEPALGJSA-N |
| XLogP | 5.04 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|