C36H34ClFN6O5 — CID 135912294
2-[4-[[3-[4-[(4-chlorophenoxy)methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]acetamide (PubChem CID 135912294) has the molecular formula C36H34ClFN6O5 and a molecular weight of 685.16 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(4-chlorophenoxy)methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[4-[[3-[4-[(4-chlorophenoxy)methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 135912294 |
| Molecular Formula | C36H34ClFN6O5 |
| Molecular Weight | 685.16 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 2-[4-[[3-[4-[(4-chlorophenoxy)methyl]phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]-2-hydroxyphenyl]methylideneamino]acetamide |
| SMILES | O=C(CN1CCN(Cc2nc(-c3ccc(COc4ccc(Cl)cc4)cc3)no2)CC1)N/N=C/c1cc(OCc2ccc(F)cc2)ccc1O |
| InChI | InChI=1S/C36H34ClFN6O5/c37-29-7-11-31(12-8-29)47-23-25-1-5-27(6-2-25)36-40-35(49-42-36)22-44-17-15-43(16-18-44)21-34(46)41-39-20-28-19-32(13-14-33(28)45)48-24-26-3-9-30(38)10-4-26/h1-14,19-20,45H,15-18,21-24H2,(H,41,46)/b39-20+ |
| InChIKey | MQHYGOAGAZIVMI-JOXMEQDKSA-N |
| XLogP | 5.66 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.16 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|