C24H27F3N4O2 — CID 137048744
N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide (PubChem CID 137048744) has the molecular formula C24H27F3N4O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 137048744 |
| Molecular Formula | C24H27F3N4O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-[(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]acetamide |
| SMILES | C=CCc1cccc(C=NNC(=O)CN2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)c1O |
| InChI | InChI=1S/C24H27F3N4O2/c1-2-4-19-5-3-6-20(23(19)33)15-28-29-22(32)17-31-13-11-30(12-14-31)16-18-7-9-21(10-8-18)24(25,26)27/h2-3,5-10,15,33H,1,4,11-14,16-17H2,(H,29,32) |
| InChIKey | IEAVQBPWJFNHOV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|