C14H24N6O4 — CID 135914671
(6R)-2-amino-5-[(2S)-2-amino-3-methylbutanoyl]-6-[(1R,2S)-1,2-dihydroxypropyl]-3,6,7,8-tetrahydropteridin-4-one (PubChem CID 135914671) has the molecular formula C14H24N6O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (6R)-2-amino-5-[(2S)-2-amino-3-methylbutanoyl]-6-[(1R,2S)-1,2-dihydroxypropyl]-3,6,7,8-tetrahydropteridin-4-one.
| Compound Name | (6R)-2-amino-5-[(2S)-2-amino-3-methylbutanoyl]-6-[(1R,2S)-1,2-dihydroxypropyl]-3,6,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 135914671 |
| Molecular Formula | C14H24N6O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (6R)-2-amino-5-[(2S)-2-amino-3-methylbutanoyl]-6-[(1R,2S)-1,2-dihydroxypropyl]-3,6,7,8-tetrahydropteridin-4-one |
| SMILES | CC(C)[C@H](N)C(=O)N1c2c(nc(N)[nH]c2=O)NC[C@@H]1[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C14H24N6O4/c1-5(2)8(15)13(24)20-7(10(22)6(3)21)4-17-11-9(20)12(23)19-14(16)18-11/h5-8,10,21-22H,4,15H2,1-3H3,(H4,16,17,18,19,23)/t6-,7+,8-,10-/m0/s1 |
| InChIKey | WZDPVKCGTVXCTO-ODHVRURNSA-N |
| XLogP | -1.80 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |