C22H20N6O2 — CID 135916319
6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135916319) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135916319 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1oc(-c2ccccc2)nc1CN1CCc2nc(-c3cncnc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C22H20N6O2/c1-14-19(26-22(30-14)15-5-3-2-4-6-15)12-28-8-7-18-17(11-28)21(29)27-20(25-18)16-9-23-13-24-10-16/h2-6,9-10,13H,7-8,11-12H2,1H3,(H,25,27,29) |
| InChIKey | VPBWDZSXDBDPRX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |