C22H20N6OS — CID 135946331
6-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135946331) has the molecular formula C22H20N6OS and a molecular weight of 416.51 g/mol. Its IUPAC name is 6-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135946331 |
| Molecular Formula | C22H20N6OS |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 6-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]-2-pyrimidin-5-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc(-c2ccccc2)sc1CN1CCc2nc(-c3cncnc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C22H20N6OS/c1-14-19(30-22(25-14)15-5-3-2-4-6-15)12-28-8-7-18-17(11-28)21(29)27-20(26-18)16-9-23-13-24-10-16/h2-6,9-10,13H,7-8,11-12H2,1H3,(H,26,27,29) |
| InChIKey | JEBFMGAVXUEFCZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |