C18H18F3N3O — CID 135920276
2-(cyclopropylmethyl)-7-[(2,3,4-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135920276) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-7-[(2,3,4-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(cyclopropylmethyl)-7-[(2,3,4-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135920276 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-(cyclopropylmethyl)-7-[(2,3,4-trifluorophenyl)methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CC2CC2)nc2c1CCN(Cc1ccc(F)c(F)c1F)C2 |
| InChI | InChI=1S/C18H18F3N3O/c19-13-4-3-11(16(20)17(13)21)8-24-6-5-12-14(9-24)22-15(23-18(12)25)7-10-1-2-10/h3-4,10H,1-2,5-9H2,(H,22,23,25) |
| InChIKey | SJYXWIBCHOZNLR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|