C22H24N6S — CID 135921319
4-methyl-5-phenyldiazenyl-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 135921319) has the molecular formula C22H24N6S and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-methyl-5-phenyldiazenyl-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-phenyldiazenyl-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135921319 |
| Molecular Formula | C22H24N6S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-methyl-5-phenyldiazenyl-N-[(E)-(4-piperidin-1-ylphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N/N=C/c2ccc(N3CCCCC3)cc2)sc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C22H24N6S/c1-17-21(26-25-19-8-4-2-5-9-19)29-22(24-17)27-23-16-18-10-12-20(13-11-18)28-14-6-3-7-15-28/h2,4-5,8-13,16H,3,6-7,14-15H2,1H3,(H,24,27)/b23-16+,26-25+ |
| InChIKey | PSKTZJCDJINFRY-XZKXACHFSA-N |
| XLogP | 6.30 |
| TPSA | 65.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|