C15H18N6O — CID 135921330
11-(1,4-diazepan-1-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one (PubChem CID 135921330) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 11-(1,4-diazepan-1-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one.
| Compound Name | 11-(1,4-diazepan-1-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one |
|---|---|
| PubChem CID | 135921330 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 11-(1,4-diazepan-1-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one |
| SMILES | O=c1[nH]nc2c3c(cccc13)NC(CN1CCCNCC1)=N2 |
| InChI | InChI=1S/C15H18N6O/c22-15-10-3-1-4-11-13(10)14(19-20-15)18-12(17-11)9-21-7-2-5-16-6-8-21/h1,3-4,16H,2,5-9H2,(H,20,22)(H,17,18,19) |
| InChIKey | IEZSFLLHKVJQPQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |