C23H14F3N3O3S2 — CID 135925834
(3R)-3-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 135925834) has the molecular formula C23H14F3N3O3S2 and a molecular weight of 501.51 g/mol. Its IUPAC name is (3R)-3-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135925834 |
| Molecular Formula | C23H14F3N3O3S2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | (3R)-3-[4-hydroxy-5-(indol-3-ylidenemethyl)-2-sulfanylidene-1,3-thiazol-3-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](n2c(O)c(C=C3C=Nc4ccccc43)sc2=S)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H14F3N3O3S2/c24-23(25,26)13-4-3-5-14(9-13)28-19(30)10-17(20(28)31)29-21(32)18(34-22(29)33)8-12-11-27-16-7-2-1-6-15(12)16/h1-9,11,17,32H,10H2/t17-/m1/s1 |
| InChIKey | UALUIRJCLIRWKF-QGZVFWFLSA-N |
| XLogP | 5.76 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|