C19H16N6O4 — CID 135926885
dimethyl 4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazole-3,5-dicarboxylate (PubChem CID 135926885) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is dimethyl 4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazole-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 135926885 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | dimethyl 4-[(4-phenyldiazenylphenyl)diazenyl]-1H-pyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1n[nH]c(C(=O)OC)c1/N=N/c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16N6O4/c1-28-18(26)16-15(17(25-24-16)19(27)29-2)23-22-14-10-8-13(9-11-14)21-20-12-6-4-3-5-7-12/h3-11H,1-2H3,(H,24,25)/b21-20+,23-22+ |
| InChIKey | WZLDZYBEVGPERV-RLJRJAJVSA-N |
| XLogP | 4.81 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|