C12H10N2O6 — CID 5256064
dimethyl 3-(furan-2-carbonyl)-1H-pyrazole-4,5-dicarboxylate (PubChem CID 5256064) has the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. Its IUPAC name is dimethyl 3-(furan-2-carbonyl)-1H-pyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(furan-2-carbonyl)-1H-pyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 5256064 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | dimethyl 3-(furan-2-carbonyl)-1H-pyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]nc(C(=O)c2ccco2)c1C(=O)OC |
| InChI | InChI=1S/C12H10N2O6/c1-18-11(16)7-8(10(15)6-4-3-5-20-6)13-14-9(7)12(17)19-2/h3-5H,1-2H3,(H,13,14) |
| InChIKey | SVHONVBJRZVDTN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |