C18H13ClF3N3O2S — CID 135927427
N-(3-chlorophenyl)-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135927427) has the molecular formula C18H13ClF3N3O2S and a molecular weight of 427.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135927427 |
| Molecular Formula | C18H13ClF3N3O2S |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\c2ccccc2C(F)(F)F)NC1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13ClF3N3O2S/c19-10-4-3-5-11(8-10)23-15(26)9-14-16(27)25-17(28-14)24-13-7-2-1-6-12(13)18(20,21)22/h1-8,14H,9H2,(H,23,26)(H,24,25,27)/t14-/m1/s1 |
| InChIKey | SFBDXAYSBXABRH-CQSZACIVSA-N |
| XLogP | 4.61 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|