C22H16F3N3O2S — CID 135927454
N-naphthalen-2-yl-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135927454) has the molecular formula C22H16F3N3O2S and a molecular weight of 443.45 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-naphthalen-2-yl-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135927454 |
| Molecular Formula | C22H16F3N3O2S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-naphthalen-2-yl-2-[(5R)-4-oxo-2-[2-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@H]1S/C(=N\c2ccccc2C(F)(F)F)NC1=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H16F3N3O2S/c23-22(24,25)16-7-3-4-8-17(16)27-21-28-20(30)18(31-21)12-19(29)26-15-10-9-13-5-1-2-6-14(13)11-15/h1-11,18H,12H2,(H,26,29)(H,27,28,30)/t18-/m1/s1 |
| InChIKey | PIPPHFOSYQDFEE-GOSISDBHSA-N |
| XLogP | 5.11 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|