C17H12ClN3O2S — CID 135927932
8-chloro-2-[(2-hydroxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135927932) has the molecular formula C17H12ClN3O2S and a molecular weight of 357.82 g/mol. Its IUPAC name is 8-chloro-2-[(2-hydroxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 8-chloro-2-[(2-hydroxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135927932 |
| Molecular Formula | C17H12ClN3O2S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 8-chloro-2-[(2-hydroxyanilino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNc2ccccc2O)nc2c1sc1ccc(Cl)cc12 |
| InChI | InChI=1S/C17H12ClN3O2S/c18-9-5-6-13-10(7-9)15-16(24-13)17(23)21-14(20-15)8-19-11-3-1-2-4-12(11)22/h1-7,19,22H,8H2,(H,20,21,23) |
| InChIKey | LYZZPEGRDNPLAU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|