C19H16ClN3O2S — CID 135927938
8-chloro-2-[[2-(3-hydroxyphenyl)ethylamino]methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135927938) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is 8-chloro-2-[[2-(3-hydroxyphenyl)ethylamino]methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 8-chloro-2-[[2-(3-hydroxyphenyl)ethylamino]methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135927938 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 8-chloro-2-[[2-(3-hydroxyphenyl)ethylamino]methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNCCc2cccc(O)c2)nc2c1sc1ccc(Cl)cc12 |
| InChI | InChI=1S/C19H16ClN3O2S/c20-12-4-5-15-14(9-12)17-18(26-15)19(25)23-16(22-17)10-21-7-6-11-2-1-3-13(24)8-11/h1-5,8-9,21,24H,6-7,10H2,(H,22,23,25) |
| InChIKey | HETRNUQWOLKNPR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|