C17H22N4O2S — CID 135928582
[(E)-(1-hexyl-4-hydroxy-2-oxoquinolin-3-yl)methylideneamino]thiourea (PubChem CID 135928582) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is [(E)-(1-hexyl-4-hydroxy-2-oxoquinolin-3-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(1-hexyl-4-hydroxy-2-oxoquinolin-3-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135928582 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [(E)-(1-hexyl-4-hydroxy-2-oxoquinolin-3-yl)methylideneamino]thiourea |
| SMILES | CCCCCCn1c(=O)c(/C=N/NC(N)=S)c(O)c2ccccc21 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-3-4-7-10-21-14-9-6-5-8-12(14)15(22)13(16(21)23)11-19-20-17(18)24/h5-6,8-9,11,22H,2-4,7,10H2,1H3,(H3,18,20,24)/b19-11+ |
| InChIKey | QBLPEXXCDFFQRC-YBFXNURJSA-N |
| XLogP | 2.45 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|