C18H23NO3 — CID 54732900
1-hexyl-4-hydroxy-3-prop-2-enoxyquinolin-2-one (PubChem CID 54732900) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-hexyl-4-hydroxy-3-prop-2-enoxyquinolin-2-one.
| Compound Name | 1-hexyl-4-hydroxy-3-prop-2-enoxyquinolin-2-one |
|---|---|
| PubChem CID | 54732900 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-hexyl-4-hydroxy-3-prop-2-enoxyquinolin-2-one |
| SMILES | C=CCOc1c(O)c2ccccc2n(CCCCCC)c1=O |
| InChI | InChI=1S/C18H23NO3/c1-3-5-6-9-12-19-15-11-8-7-10-14(15)16(20)17(18(19)21)22-13-4-2/h4,7-8,10-11,20H,2-3,5-6,9,12-13H2,1H3 |
| InChIKey | FKCZHEFAYGPHDT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|