C26H31NO4 — CID 54716374
4-hydroxy-1-octyl-3-phenoxy-6-prop-2-enoxyquinolin-2-one (PubChem CID 54716374) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-hydroxy-1-octyl-3-phenoxy-6-prop-2-enoxyquinolin-2-one.
| Compound Name | 4-hydroxy-1-octyl-3-phenoxy-6-prop-2-enoxyquinolin-2-one |
|---|---|
| PubChem CID | 54716374 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-hydroxy-1-octyl-3-phenoxy-6-prop-2-enoxyquinolin-2-one |
| SMILES | C=CCOc1ccc2c(c1)c(O)c(Oc1ccccc1)c(=O)n2CCCCCCCC |
| InChI | InChI=1S/C26H31NO4/c1-3-5-6-7-8-12-17-27-23-16-15-21(30-18-4-2)19-22(23)24(28)25(26(27)29)31-20-13-10-9-11-14-20/h4,9-11,13-16,19,28H,2-3,5-8,12,17-18H2,1H3 |
| InChIKey | XMHLGNOUYXNZQG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|