C24H26FN3O3 — CID 98126432
N-[(Z)-(2-fluorophenyl)methylideneamino]-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide (PubChem CID 98126432) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[(Z)-(2-fluorophenyl)methylideneamino]-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide.
| Compound Name | N-[(Z)-(2-fluorophenyl)methylideneamino]-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 98126432 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[(Z)-(2-fluorophenyl)methylideneamino]-1-heptyl-4-hydroxy-2-oxoquinoline-3-carboxamide |
| SMILES | CCCCCCCn1c(=O)c(C(=O)N/N=C\c2ccccc2F)c(O)c2ccccc21 |
| InChI | InChI=1S/C24H26FN3O3/c1-2-3-4-5-10-15-28-20-14-9-7-12-18(20)22(29)21(24(28)31)23(30)27-26-16-17-11-6-8-13-19(17)25/h6-9,11-14,16,29H,2-5,10,15H2,1H3,(H,27,30)/b26-16- |
| InChIKey | IYYWZKXBXQCLFM-QQXSKIMKSA-N |
| XLogP | 4.58 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|