C14H13N5O2 — CID 135931174
2-amino-9-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-1H-purin-6-one (PubChem CID 135931174) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-amino-9-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135931174 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-amino-9-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2c3ccccc3C[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H13N5O2/c15-14-17-12-10(13(21)18-14)16-6-19(12)11-8-4-2-1-3-7(8)5-9(11)20/h1-4,6,9,11,20H,5H2,(H3,15,17,18,21)/t9-,11+/m0/s1 |
| InChIKey | SIHRQQJSKLXVBD-GXSJLCMTSA-N |
| XLogP | 0.21 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |