C14H11NO4 — CID 135932451
3-[2-(furan-2-yl)ethanimidoyl]-1-benzofuran-2,5-diol (PubChem CID 135932451) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)ethanimidoyl]-1-benzofuran-2,5-diol.
| Compound Name | 3-[2-(furan-2-yl)ethanimidoyl]-1-benzofuran-2,5-diol |
|---|---|
| PubChem CID | 135932451 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-[2-(furan-2-yl)ethanimidoyl]-1-benzofuran-2,5-diol |
| SMILES | [H]/N=C(\Cc1ccco1)c1c(O)oc2ccc(O)cc12 |
| InChI | InChI=1S/C14H11NO4/c15-11(7-9-2-1-5-18-9)13-10-6-8(16)3-4-12(10)19-14(13)17/h1-6,15-17H,7H2/b15-11+ |
| InChIKey | FFGROTHVINLSIA-RVDMUPIBSA-N |
| XLogP | 3.05 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|