About (2E)-2-diazo-1,2-diphenylethanone
(2E)-2-diazo-1,2-diphenylethanone (PubChem CID 135932817) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is (2E)-2-diazo-1,2-diphenylethanone.
Molecular Properties
| Compound Name | (2E)-2-diazo-1,2-diphenylethanone |
| PubChem CID | 135932817 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (2E)-2-diazo-1,2-diphenylethanone |
| SMILES | [N-]=[N+]=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10N2O/c15-16-13(11-7-3-1-4-8-11)14(17)12-9-5-2-6-10-12/h1-10H |
| InChIKey | LVLXAIROXMLXJY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-diazo-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-diazo-1,2-diphenylethanone?
The IUPAC name of (2E)-2-diazo-1,2-diphenylethanone (CID 135932817) is (2E)-2-diazo-1,2-diphenylethanone.
What is the SMILES notation for (2E)-2-diazo-1,2-diphenylethanone?
The canonical SMILES for (2E)-2-diazo-1,2-diphenylethanone is [N-]=[N+]=C(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (2E)-2-diazo-1,2-diphenylethanone?
The InChIKey is LVLXAIROXMLXJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c15-16-13(11-7-3-1-4-8-11)14(17)12-9-5-2-6-10-12/h1-10H.
What are the key properties of (2E)-2-diazo-1,2-diphenylethanone?
(2E)-2-diazo-1,2-diphenylethanone has a molecular weight of 222.25 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-diazo-1,2-diphenylethanone is sourced from PubChem (CID 135932817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).