C29H26N2O3S — CID 135937278
2-[4-(4-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-2,3-dihydro-1,5-benzothiazepin-2-yl]phenol (PubChem CID 135937278) has the molecular formula C29H26N2O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-[4-(4-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-2,3-dihydro-1,5-benzothiazepin-2-yl]phenol.
| Compound Name | 2-[4-(4-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-2,3-dihydro-1,5-benzothiazepin-2-yl]phenol |
|---|---|
| PubChem CID | 135937278 |
| Molecular Formula | C29H26N2O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-[4-(4-hydroxyphenyl)-3-[(4-methoxyanilino)methyl]-2,3-dihydro-1,5-benzothiazepin-2-yl]phenol |
| SMILES | COc1ccc(NCC2C(c3ccc(O)cc3)=Nc3ccccc3SC2c2ccccc2O)cc1 |
| InChI | InChI=1S/C29H26N2O3S/c1-34-22-16-12-20(13-17-22)30-18-24-28(19-10-14-21(32)15-11-19)31-25-7-3-5-9-27(25)35-29(24)23-6-2-4-8-26(23)33/h2-17,24,29-30,32-33H,18H2,1H3 |
| InChIKey | WYDWLUGKXWCUJC-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|