C21H14Br2ClN3O3S — CID 135939453
2-chloro-N-[(E)-3-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 135939453) has the molecular formula C21H14Br2ClN3O3S and a molecular weight of 583.69 g/mol. Its IUPAC name is 2-chloro-N-[(E)-3-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(E)-3-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135939453 |
| Molecular Formula | C21H14Br2ClN3O3S |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 580.88 |
| IUPAC Name | 2-chloro-N-[(E)-3-[(2E)-2-[(3,5-dibromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/N=C/c1cc(Br)cc(Br)c1O)/C(=C\c1cccs1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H14Br2ClN3O3S/c22-13-8-12(19(28)16(23)9-13)11-25-27-21(30)18(10-14-4-3-7-31-14)26-20(29)15-5-1-2-6-17(15)24/h1-11,28H,(H,26,29)(H,27,30)/b18-10+,25-11+ |
| InChIKey | KRPLXAKCLRCAQQ-IFVZJPDBSA-N |
| XLogP | 5.55 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|