C20H15ClN4O2S — CID 78460823
2-chloro-N-[3-oxo-3-[2-(pyridin-4-ylmethylidene)hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 78460823) has the molecular formula C20H15ClN4O2S and a molecular weight of 410.89 g/mol. Its IUPAC name is 2-chloro-N-[3-oxo-3-[2-(pyridin-4-ylmethylidene)hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-oxo-3-[2-(pyridin-4-ylmethylidene)hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 78460823 |
| Molecular Formula | C20H15ClN4O2S |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-chloro-N-[3-oxo-3-[2-(pyridin-4-ylmethylidene)hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccncc1)C(=Cc1cccs1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H15ClN4O2S/c21-17-6-2-1-5-16(17)19(26)24-18(12-15-4-3-11-28-15)20(27)25-23-13-14-7-9-22-10-8-14/h1-13H,(H,24,26)(H,25,27) |
| InChIKey | BIYZAXOZCSKVAE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|