C24H19ClN4O2S — CID 137231510
2-chloro-N-[(Z)-3-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 137231510) has the molecular formula C24H19ClN4O2S and a molecular weight of 462.96 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-3-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(Z)-3-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 137231510 |
| Molecular Formula | C24H19ClN4O2S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-chloro-N-[(Z)-3-[2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | Cc1[nH]c2ccccc2c1C=NNC(=O)/C(=C/c1cccs1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H19ClN4O2S/c1-15-19(17-8-3-5-11-21(17)27-15)14-26-29-24(31)22(13-16-7-6-12-32-16)28-23(30)18-9-2-4-10-20(18)25/h2-14,27H,1H3,(H,28,30)(H,29,31)/b22-13-,26-14? |
| InChIKey | VYHPTBVVJFWIIB-NOBHJTLCSA-N |
| XLogP | 5.11 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|