C21H21FN4O5 — CID 135944501
2-tert-butyl-6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944501) has the molecular formula C21H21FN4O5 and a molecular weight of 428.42 g/mol. Its IUPAC name is 2-tert-butyl-6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-tert-butyl-6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944501 |
| Molecular Formula | C21H21FN4O5 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-tert-butyl-6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)(C)c1nc2c(c(=O)[nH]1)CN(Cc1coc3c([N+](=O)[O-])cc(F)cc3c1=O)CC2 |
| InChI | InChI=1S/C21H21FN4O5/c1-21(2,3)20-23-15-4-5-25(9-14(15)19(28)24-20)8-11-10-31-18-13(17(11)27)6-12(22)7-16(18)26(29)30/h6-7,10H,4-5,8-9H2,1-3H3,(H,23,24,28) |
| InChIKey | DOYJEYBLZWWZRW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|