C22H20FN5O5 — CID 135944504
6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944504) has the molecular formula C22H20FN5O5 and a molecular weight of 453.43 g/mol. Its IUPAC name is 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944504 |
| Molecular Formula | C22H20FN5O5 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2=NCCCC2)nc2c1CN(Cc1coc3c([N+](=O)[O-])cc(F)cc3c1=O)CC2 |
| InChI | InChI=1S/C22H20FN5O5/c23-13-7-14-19(29)12(11-33-20(14)18(8-13)28(31)32)9-27-6-4-16-15(10-27)22(30)26-21(25-16)17-3-1-2-5-24-17/h7-8,11H,1-6,9-10H2,(H,25,26,30) |
| InChIKey | KZKKTBAFIKZLMK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|