C25H21ClN6OS — CID 135944866
6-[[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944866) has the molecular formula C25H21ClN6OS and a molecular weight of 489.00 g/mol. Its IUPAC name is 6-[[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944866 |
| Molecular Formula | C25H21ClN6OS |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 6-[[1-[(2-chloro-1,3-thiazol-5-yl)methyl]indol-3-yl]methyl]-2-pyridin-4-yl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccncc2)nc2c1CN(Cc1cn(Cc3cnc(Cl)s3)c3ccccc13)CC2 |
| InChI | InChI=1S/C25H21ClN6OS/c26-25-28-11-18(34-25)14-32-13-17(19-3-1-2-4-22(19)32)12-31-10-7-21-20(15-31)24(33)30-23(29-21)16-5-8-27-9-6-16/h1-6,8-9,11,13H,7,10,12,14-15H2,(H,29,30,33) |
| InChIKey | FTFHEPQJRQMVKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |